C10H15N5O2S2 — CID 106077162
5-(methylaminomethyl)-N-[2-(triazol-1-yl)ethyl]thiophene-2-sulfonamide (PubChem CID 106077162) has the molecular formula C10H15N5O2S2 and a molecular weight of 301.40 g/mol. Its IUPAC name is 5-(methylaminomethyl)-N-[2-(triazol-1-yl)ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-(methylaminomethyl)-N-[2-(triazol-1-yl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106077162 |
| Molecular Formula | C10H15N5O2S2 |
| Molecular Weight | 301.40 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 5-(methylaminomethyl)-N-[2-(triazol-1-yl)ethyl]thiophene-2-sulfonamide |
| SMILES | CNCc1ccc(S(=O)(=O)NCCn2ccnn2)s1 |
| InChI | InChI=1S/C10H15N5O2S2/c1-11-8-9-2-3-10(18-9)19(16,17)13-5-7-15-6-4-12-14-15/h2-4,6,11,13H,5,7-8H2,1H3 |
| InChIKey | YVLYPXUTLZXLIE-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.40 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |