C8H11NO6S2 — CID 66171444
5-(2,3-dihydroxypropylsulfamoyl)thiophene-2-carboxylic acid (PubChem CID 66171444) has the molecular formula C8H11NO6S2 and a molecular weight of 281.31 g/mol. Its IUPAC name is 5-(2,3-dihydroxypropylsulfamoyl)thiophene-2-carboxylic acid.
| Compound Name | 5-(2,3-dihydroxypropylsulfamoyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 66171444 |
| Molecular Formula | C8H11NO6S2 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.00 |
| IUPAC Name | 5-(2,3-dihydroxypropylsulfamoyl)thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)NCC(O)CO)s1 |
| InChI | InChI=1S/C8H11NO6S2/c10-4-5(11)3-9-17(14,15)7-2-1-6(16-7)8(12)13/h1-2,5,9-11H,3-4H2,(H,12,13) |
| InChIKey | QKZCSPSVWARKSY-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |