C12H19NO5S2 — CID 106003735
5-(4-propan-2-yloxybutylsulfamoyl)thiophene-2-carboxylic acid (PubChem CID 106003735) has the molecular formula C12H19NO5S2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 5-(4-propan-2-yloxybutylsulfamoyl)thiophene-2-carboxylic acid.
| Compound Name | 5-(4-propan-2-yloxybutylsulfamoyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 106003735 |
| Molecular Formula | C12H19NO5S2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 5-(4-propan-2-yloxybutylsulfamoyl)thiophene-2-carboxylic acid |
| SMILES | CC(C)OCCCCNS(=O)(=O)c1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C12H19NO5S2/c1-9(2)18-8-4-3-7-13-20(16,17)11-6-5-10(19-11)12(14)15/h5-6,9,13H,3-4,7-8H2,1-2H3,(H,14,15) |
| InChIKey | FZQXZYODNMOOTR-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|