C12H19NO6S — CID 106003753
5-(4-propan-2-yloxybutylsulfamoyl)furan-2-carboxylic acid (PubChem CID 106003753) has the molecular formula C12H19NO6S and a molecular weight of 305.35 g/mol. Its IUPAC name is 5-(4-propan-2-yloxybutylsulfamoyl)furan-2-carboxylic acid.
| Compound Name | 5-(4-propan-2-yloxybutylsulfamoyl)furan-2-carboxylic acid |
|---|---|
| PubChem CID | 106003753 |
| Molecular Formula | C12H19NO6S |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 5-(4-propan-2-yloxybutylsulfamoyl)furan-2-carboxylic acid |
| SMILES | CC(C)OCCCCNS(=O)(=O)c1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C12H19NO6S/c1-9(2)18-8-4-3-7-13-20(16,17)11-6-5-10(19-11)12(14)15/h5-6,9,13H,3-4,7-8H2,1-2H3,(H,14,15) |
| InChIKey | BSMQYZVRESRTBC-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|