C10H15NO5S3 — CID 106156119
5-[(4-hydroxy-3-methylsulfanylbutan-2-yl)sulfamoyl]thiophene-2-carboxylic acid (PubChem CID 106156119) has the molecular formula C10H15NO5S3 and a molecular weight of 325.43 g/mol. Its IUPAC name is 5-[(4-hydroxy-3-methylsulfanylbutan-2-yl)sulfamoyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[(4-hydroxy-3-methylsulfanylbutan-2-yl)sulfamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 106156119 |
| Molecular Formula | C10H15NO5S3 |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.01 |
| IUPAC Name | 5-[(4-hydroxy-3-methylsulfanylbutan-2-yl)sulfamoyl]thiophene-2-carboxylic acid |
| SMILES | CSC(CO)C(C)NS(=O)(=O)c1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C10H15NO5S3/c1-6(8(5-12)17-2)11-19(15,16)9-4-3-7(18-9)10(13)14/h3-4,6,8,11-12H,5H2,1-2H3,(H,13,14) |
| InChIKey | ISNAQGPTZPBFJU-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |