C11H11ClN2O3S2 — CID 110717401
5-chloro-2-methoxy-N-(1,3-thiazol-4-ylmethyl)benzenesulfonamide (PubChem CID 110717401) has the molecular formula C11H11ClN2O3S2 and a molecular weight of 318.81 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N-(1,3-thiazol-4-ylmethyl)benzenesulfonamide.
| Compound Name | 5-chloro-2-methoxy-N-(1,3-thiazol-4-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 110717401 |
| Molecular Formula | C11H11ClN2O3S2 |
| Molecular Weight | 318.81 g/mol |
| Exact Mass | 317.99 |
| IUPAC Name | 5-chloro-2-methoxy-N-(1,3-thiazol-4-ylmethyl)benzenesulfonamide |
| SMILES | COc1ccc(Cl)cc1S(=O)(=O)NCc1cscn1 |
| InChI | InChI=1S/C11H11ClN2O3S2/c1-17-10-3-2-8(12)4-11(10)19(15,16)14-5-9-6-18-7-13-9/h2-4,6-7,14H,5H2,1H3 |
| InChIKey | JPECVXAGRGNXRW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.81 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |