C10H9F2N3O2S2 — CID 107343564
3-amino-2,4-difluoro-N-(1,3-thiazol-4-ylmethyl)benzenesulfonamide (PubChem CID 107343564) has the molecular formula C10H9F2N3O2S2 and a molecular weight of 305.33 g/mol. Its IUPAC name is 3-amino-2,4-difluoro-N-(1,3-thiazol-4-ylmethyl)benzenesulfonamide.
| Compound Name | 3-amino-2,4-difluoro-N-(1,3-thiazol-4-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 107343564 |
| Molecular Formula | C10H9F2N3O2S2 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 3-amino-2,4-difluoro-N-(1,3-thiazol-4-ylmethyl)benzenesulfonamide |
| SMILES | Nc1c(F)ccc(S(=O)(=O)NCc2cscn2)c1F |
| InChI | InChI=1S/C10H9F2N3O2S2/c11-7-1-2-8(9(12)10(7)13)19(16,17)15-3-6-4-18-5-14-6/h1-2,4-5,15H,3,13H2 |
| InChIKey | QBJVZWIOTFCARF-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|