C10H10N4O4S2 — CID 63824001
2-amino-5-nitro-N-(1,3-thiazol-4-ylmethyl)benzenesulfonamide (PubChem CID 63824001) has the molecular formula C10H10N4O4S2 and a molecular weight of 314.35 g/mol. Its IUPAC name is 2-amino-5-nitro-N-(1,3-thiazol-4-ylmethyl)benzenesulfonamide.
| Compound Name | 2-amino-5-nitro-N-(1,3-thiazol-4-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 63824001 |
| Molecular Formula | C10H10N4O4S2 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | 2-amino-5-nitro-N-(1,3-thiazol-4-ylmethyl)benzenesulfonamide |
| SMILES | Nc1ccc([N+](=O)[O-])cc1S(=O)(=O)NCc1cscn1 |
| InChI | InChI=1S/C10H10N4O4S2/c11-9-2-1-8(14(15)16)3-10(9)20(17,18)13-4-7-5-19-6-12-7/h1-3,5-6,13H,4,11H2 |
| InChIKey | JZGHKOOJZCHMPZ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|