C10H10F2N4O2S — CID 107343653
3-amino-2,4-difluoro-N-(1H-imidazol-5-ylmethyl)benzenesulfonamide (PubChem CID 107343653) has the molecular formula C10H10F2N4O2S and a molecular weight of 288.28 g/mol. Its IUPAC name is 3-amino-2,4-difluoro-N-(1H-imidazol-5-ylmethyl)benzenesulfonamide.
| Compound Name | 3-amino-2,4-difluoro-N-(1H-imidazol-5-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 107343653 |
| Molecular Formula | C10H10F2N4O2S |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 3-amino-2,4-difluoro-N-(1H-imidazol-5-ylmethyl)benzenesulfonamide |
| SMILES | Nc1c(F)ccc(S(=O)(=O)NCc2cnc[nH]2)c1F |
| InChI | InChI=1S/C10H10F2N4O2S/c11-7-1-2-8(9(12)10(7)13)19(17,18)16-4-6-3-14-5-15-6/h1-3,5,16H,4,13H2,(H,14,15) |
| InChIKey | DPBGEZGEZJLBIZ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|