C11H12N2O3S — CID 110719016
3-methyl-N-(1,3-oxazol-4-ylmethyl)benzenesulfonamide (PubChem CID 110719016) has the molecular formula C11H12N2O3S and a molecular weight of 252.30 g/mol. Its IUPAC name is 3-methyl-N-(1,3-oxazol-4-ylmethyl)benzenesulfonamide.
| Compound Name | 3-methyl-N-(1,3-oxazol-4-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 110719016 |
| Molecular Formula | C11H12N2O3S |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 3-methyl-N-(1,3-oxazol-4-ylmethyl)benzenesulfonamide |
| SMILES | Cc1cccc(S(=O)(=O)NCc2cocn2)c1 |
| InChI | InChI=1S/C11H12N2O3S/c1-9-3-2-4-11(5-9)17(14,15)13-6-10-7-16-8-12-10/h2-5,7-8,13H,6H2,1H3 |
| InChIKey | HTAZYGVLFBIKJR-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |