C19H15NOS — CID 141142134
4-[2-[4-(2-phenylethynyl)phenoxy]ethyl]-1,3-thiazole (PubChem CID 141142134) has the molecular formula C19H15NOS and a molecular weight of 305.40 g/mol. Its IUPAC name is 4-[2-[4-(2-phenylethynyl)phenoxy]ethyl]-1,3-thiazole.
| Compound Name | 4-[2-[4-(2-phenylethynyl)phenoxy]ethyl]-1,3-thiazole |
|---|---|
| PubChem CID | 141142134 |
| Molecular Formula | C19H15NOS |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 4-[2-[4-(2-phenylethynyl)phenoxy]ethyl]-1,3-thiazole |
| SMILES | C(#Cc1ccc(OCCc2cscn2)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H15NOS/c1-2-4-16(5-3-1)6-7-17-8-10-19(11-9-17)21-13-12-18-14-22-15-20-18/h1-5,8-11,14-15H,12-13H2 |
| InChIKey | IJTDEHWQHVOVHS-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|