C12H15N5O2S — CID 114386974
3-amino-2,4,6-trimethyl-N-(1,2,4-triazin-3-yl)benzenesulfonamide (PubChem CID 114386974) has the molecular formula C12H15N5O2S and a molecular weight of 293.35 g/mol. Its IUPAC name is 3-amino-2,4,6-trimethyl-N-(1,2,4-triazin-3-yl)benzenesulfonamide.
| Compound Name | 3-amino-2,4,6-trimethyl-N-(1,2,4-triazin-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 114386974 |
| Molecular Formula | C12H15N5O2S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 3-amino-2,4,6-trimethyl-N-(1,2,4-triazin-3-yl)benzenesulfonamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)Nc2nccnn2)c(C)c1N |
| InChI | InChI=1S/C12H15N5O2S/c1-7-6-8(2)11(9(3)10(7)13)20(18,19)17-12-14-4-5-15-16-12/h4-6H,13H2,1-3H3,(H,14,16,17) |
| InChIKey | WZQRGMYHHPKEEF-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|