C8H7BrN4O2S2 — CID 114389150
5-bromo-4-methyl-N-(1,2,4-triazin-3-yl)thiophene-2-sulfonamide (PubChem CID 114389150) has the molecular formula C8H7BrN4O2S2 and a molecular weight of 335.21 g/mol. Its IUPAC name is 5-bromo-4-methyl-N-(1,2,4-triazin-3-yl)thiophene-2-sulfonamide.
| Compound Name | 5-bromo-4-methyl-N-(1,2,4-triazin-3-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 114389150 |
| Molecular Formula | C8H7BrN4O2S2 |
| Molecular Weight | 335.21 g/mol |
| Exact Mass | 333.92 |
| IUPAC Name | 5-bromo-4-methyl-N-(1,2,4-triazin-3-yl)thiophene-2-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)Nc2nccnn2)sc1Br |
| InChI | InChI=1S/C8H7BrN4O2S2/c1-5-4-6(16-7(5)9)17(14,15)13-8-10-2-3-11-12-8/h2-4H,1H3,(H,10,12,13) |
| InChIKey | SCSSJZTWZWLHQC-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.21 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |