C11H9BrFNO2S2 — CID 79933721
5-bromo-N-(4-fluorophenyl)-4-methylthiophene-2-sulfonamide (PubChem CID 79933721) has the molecular formula C11H9BrFNO2S2 and a molecular weight of 350.23 g/mol. Its IUPAC name is 5-bromo-N-(4-fluorophenyl)-4-methylthiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-(4-fluorophenyl)-4-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 79933721 |
| Molecular Formula | C11H9BrFNO2S2 |
| Molecular Weight | 350.23 g/mol |
| Exact Mass | 348.92 |
| IUPAC Name | 5-bromo-N-(4-fluorophenyl)-4-methylthiophene-2-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)Nc2ccc(F)cc2)sc1Br |
| InChI | InChI=1S/C11H9BrFNO2S2/c1-7-6-10(17-11(7)12)18(15,16)14-9-4-2-8(13)3-5-9/h2-6,14H,1H3 |
| InChIKey | QRNKKRFIFLLYDH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.23 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |