C11H8BrCl2NO2S2 — CID 79995879
5-bromo-N-(3,5-dichlorophenyl)-4-methylthiophene-2-sulfonamide (PubChem CID 79995879) has the molecular formula C11H8BrCl2NO2S2 and a molecular weight of 401.13 g/mol. Its IUPAC name is 5-bromo-N-(3,5-dichlorophenyl)-4-methylthiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-(3,5-dichlorophenyl)-4-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 79995879 |
| Molecular Formula | C11H8BrCl2NO2S2 |
| Molecular Weight | 401.13 g/mol |
| Exact Mass | 398.86 |
| IUPAC Name | 5-bromo-N-(3,5-dichlorophenyl)-4-methylthiophene-2-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)Nc2cc(Cl)cc(Cl)c2)sc1Br |
| InChI | InChI=1S/C11H8BrCl2NO2S2/c1-6-2-10(18-11(6)12)19(16,17)15-9-4-7(13)3-8(14)5-9/h2-5,15H,1H3 |
| InChIKey | JMLWMLFLDKSVAT-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.13 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |