C11H11BrN2O4S3 — CID 79912739
5-bromo-4-methyl-N-(3-sulfamoylphenyl)thiophene-2-sulfonamide (PubChem CID 79912739) has the molecular formula C11H11BrN2O4S3 and a molecular weight of 411.32 g/mol. Its IUPAC name is 5-bromo-4-methyl-N-(3-sulfamoylphenyl)thiophene-2-sulfonamide.
| Compound Name | 5-bromo-4-methyl-N-(3-sulfamoylphenyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 79912739 |
| Molecular Formula | C11H11BrN2O4S3 |
| Molecular Weight | 411.32 g/mol |
| Exact Mass | 409.91 |
| IUPAC Name | 5-bromo-4-methyl-N-(3-sulfamoylphenyl)thiophene-2-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)Nc2cccc(S(N)(=O)=O)c2)sc1Br |
| InChI | InChI=1S/C11H11BrN2O4S3/c1-7-5-10(19-11(7)12)21(17,18)14-8-3-2-4-9(6-8)20(13,15)16/h2-6,14H,1H3,(H2,13,15,16) |
| InChIKey | KCROVEJLUTZHPS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |