C14H17BrN2O2S2 — CID 79998136
5-bromo-N-[3-(ethylaminomethyl)phenyl]-4-methylthiophene-2-sulfonamide (PubChem CID 79998136) has the molecular formula C14H17BrN2O2S2 and a molecular weight of 389.34 g/mol. Its IUPAC name is 5-bromo-N-[3-(ethylaminomethyl)phenyl]-4-methylthiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-[3-(ethylaminomethyl)phenyl]-4-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 79998136 |
| Molecular Formula | C14H17BrN2O2S2 |
| Molecular Weight | 389.34 g/mol |
| Exact Mass | 387.99 |
| IUPAC Name | 5-bromo-N-[3-(ethylaminomethyl)phenyl]-4-methylthiophene-2-sulfonamide |
| SMILES | CCNCc1cccc(NS(=O)(=O)c2cc(C)c(Br)s2)c1 |
| InChI | InChI=1S/C14H17BrN2O2S2/c1-3-16-9-11-5-4-6-12(8-11)17-21(18,19)13-7-10(2)14(15)20-13/h4-8,16-17H,3,9H2,1-2H3 |
| InChIKey | IEZIIWNGFDWQMA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.34 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |