C11H10BrClN2O2S2 — CID 80577855
N-[3-(aminomethyl)phenyl]-5-bromo-4-chlorothiophene-2-sulfonamide (PubChem CID 80577855) has the molecular formula C11H10BrClN2O2S2 and a molecular weight of 381.70 g/mol. Its IUPAC name is N-[3-(aminomethyl)phenyl]-5-bromo-4-chlorothiophene-2-sulfonamide.
| Compound Name | N-[3-(aminomethyl)phenyl]-5-bromo-4-chlorothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80577855 |
| Molecular Formula | C11H10BrClN2O2S2 |
| Molecular Weight | 381.70 g/mol |
| Exact Mass | 379.91 |
| IUPAC Name | N-[3-(aminomethyl)phenyl]-5-bromo-4-chlorothiophene-2-sulfonamide |
| SMILES | NCc1cccc(NS(=O)(=O)c2cc(Cl)c(Br)s2)c1 |
| InChI | InChI=1S/C11H10BrClN2O2S2/c12-11-9(13)5-10(18-11)19(16,17)15-8-3-1-2-7(4-8)6-14/h1-5,15H,6,14H2 |
| InChIKey | MRUOBBPAMCTIDR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.70 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |