C13H14BrClN2O2S2 — CID 80578453
5-bromo-4-chloro-N-[3-[(dimethylamino)methyl]phenyl]thiophene-2-sulfonamide (PubChem CID 80578453) has the molecular formula C13H14BrClN2O2S2 and a molecular weight of 409.76 g/mol. Its IUPAC name is 5-bromo-4-chloro-N-[3-[(dimethylamino)methyl]phenyl]thiophene-2-sulfonamide.
| Compound Name | 5-bromo-4-chloro-N-[3-[(dimethylamino)methyl]phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80578453 |
| Molecular Formula | C13H14BrClN2O2S2 |
| Molecular Weight | 409.76 g/mol |
| Exact Mass | 407.94 |
| IUPAC Name | 5-bromo-4-chloro-N-[3-[(dimethylamino)methyl]phenyl]thiophene-2-sulfonamide |
| SMILES | CN(C)Cc1cccc(NS(=O)(=O)c2cc(Cl)c(Br)s2)c1 |
| InChI | InChI=1S/C13H14BrClN2O2S2/c1-17(2)8-9-4-3-5-10(6-9)16-21(18,19)12-7-11(15)13(14)20-12/h3-7,16H,8H2,1-2H3 |
| InChIKey | OXKMQPNQDAXNHD-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.76 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |