C9H14N2O3S — CID 123946083
[3-[(dimethylamino)methyl]phenyl]sulfamic acid (PubChem CID 123946083) has the molecular formula C9H14N2O3S and a molecular weight of 230.29 g/mol. Its IUPAC name is [3-[(dimethylamino)methyl]phenyl]sulfamic acid.
| Compound Name | [3-[(dimethylamino)methyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 123946083 |
| Molecular Formula | C9H14N2O3S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | [3-[(dimethylamino)methyl]phenyl]sulfamic acid |
| SMILES | CN(C)Cc1cccc(NS(=O)(=O)O)c1 |
| InChI | InChI=1S/C9H14N2O3S/c1-11(2)7-8-4-3-5-9(6-8)10-15(12,13)14/h3-6,10H,7H2,1-2H3,(H,12,13,14) |
| InChIKey | YJAQIAGVWSZCKK-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|