C11H19Cl2N3O — CID 119853176
2-amino-N-[3-[(dimethylamino)methyl]phenyl]acetamide;dihydrochloride (PubChem CID 119853176) has the molecular formula C11H19Cl2N3O and a molecular weight of 280.20 g/mol. Its IUPAC name is 2-amino-N-[3-[(dimethylamino)methyl]phenyl]acetamide;dihydrochloride.
| Compound Name | 2-amino-N-[3-[(dimethylamino)methyl]phenyl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119853176 |
| Molecular Formula | C11H19Cl2N3O |
| Molecular Weight | 280.20 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 2-amino-N-[3-[(dimethylamino)methyl]phenyl]acetamide;dihydrochloride |
| SMILES | CN(C)Cc1cccc(NC(=O)CN)c1.Cl.Cl |
| InChI | InChI=1S/C11H17N3O.2ClH/c1-14(2)8-9-4-3-5-10(6-9)13-11(15)7-12;;/h3-6H,7-8,12H2,1-2H3,(H,13,15);2*1H |
| InChIKey | SXLNJPFOHXXQEB-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.20 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |