C10H14N2O3 — CID 175163451
2-amino-N-[3-(2,2-dihydroxyethyl)phenyl]acetamide (PubChem CID 175163451) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is 2-amino-N-[3-(2,2-dihydroxyethyl)phenyl]acetamide.
| Compound Name | 2-amino-N-[3-(2,2-dihydroxyethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 175163451 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 2-amino-N-[3-(2,2-dihydroxyethyl)phenyl]acetamide |
| SMILES | NCC(=O)Nc1cccc(CC(O)O)c1 |
| InChI | InChI=1S/C10H14N2O3/c11-6-9(13)12-8-3-1-2-7(4-8)5-10(14)15/h1-4,10,14-15H,5-6,11H2,(H,12,13) |
| InChIKey | QWISFJIKZYMCHE-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|