C14H17ClN2O2S2 — CID 103100364
5-chloro-N-[3-(ethylaminomethyl)phenyl]-4-methylthiophene-2-sulfonamide (PubChem CID 103100364) has the molecular formula C14H17ClN2O2S2 and a molecular weight of 344.89 g/mol. Its IUPAC name is 5-chloro-N-[3-(ethylaminomethyl)phenyl]-4-methylthiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[3-(ethylaminomethyl)phenyl]-4-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 103100364 |
| Molecular Formula | C14H17ClN2O2S2 |
| Molecular Weight | 344.89 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 5-chloro-N-[3-(ethylaminomethyl)phenyl]-4-methylthiophene-2-sulfonamide |
| SMILES | CCNCc1cccc(NS(=O)(=O)c2cc(C)c(Cl)s2)c1 |
| InChI | InChI=1S/C14H17ClN2O2S2/c1-3-16-9-11-5-4-6-12(8-11)17-21(18,19)13-7-10(2)14(15)20-13/h4-8,16-17H,3,9H2,1-2H3 |
| InChIKey | VHCOLDMPRATMPW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.89 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |