C7H11ClN4O2S — CID 114389018
3-chloro-2-methyl-N-(1,2,4-triazin-3-yl)propane-1-sulfonamide (PubChem CID 114389018) has the molecular formula C7H11ClN4O2S and a molecular weight of 250.71 g/mol. Its IUPAC name is 3-chloro-2-methyl-N-(1,2,4-triazin-3-yl)propane-1-sulfonamide.
| Compound Name | 3-chloro-2-methyl-N-(1,2,4-triazin-3-yl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 114389018 |
| Molecular Formula | C7H11ClN4O2S |
| Molecular Weight | 250.71 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 3-chloro-2-methyl-N-(1,2,4-triazin-3-yl)propane-1-sulfonamide |
| SMILES | CC(CCl)CS(=O)(=O)Nc1nccnn1 |
| InChI | InChI=1S/C7H11ClN4O2S/c1-6(4-8)5-15(13,14)12-7-9-2-3-10-11-7/h2-3,6H,4-5H2,1H3,(H,9,11,12) |
| InChIKey | JURQQMURXPVPCF-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.71 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|