C13H16ClN3O3S — CID 79557380
3-chloro-2-methyl-N-[2-methyl-4-(1,3,4-oxadiazol-2-yl)phenyl]propane-1-sulfonamide (PubChem CID 79557380) has the molecular formula C13H16ClN3O3S and a molecular weight of 329.81 g/mol. Its IUPAC name is 3-chloro-2-methyl-N-[2-methyl-4-(1,3,4-oxadiazol-2-yl)phenyl]propane-1-sulfonamide.
| Compound Name | 3-chloro-2-methyl-N-[2-methyl-4-(1,3,4-oxadiazol-2-yl)phenyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 79557380 |
| Molecular Formula | C13H16ClN3O3S |
| Molecular Weight | 329.81 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 3-chloro-2-methyl-N-[2-methyl-4-(1,3,4-oxadiazol-2-yl)phenyl]propane-1-sulfonamide |
| SMILES | Cc1cc(-c2nnco2)ccc1NS(=O)(=O)CC(C)CCl |
| InChI | InChI=1S/C13H16ClN3O3S/c1-9(6-14)7-21(18,19)17-12-4-3-11(5-10(12)2)13-16-15-8-20-13/h3-5,8-9,17H,6-7H2,1-2H3 |
| InChIKey | ZRXUSNSMSOFYRI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.81 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|