C10H6ClN5O2S — CID 114387982
2-chloro-5-cyano-N-(1,2,4-triazin-3-yl)benzenesulfonamide (PubChem CID 114387982) has the molecular formula C10H6ClN5O2S and a molecular weight of 295.71 g/mol. Its IUPAC name is 2-chloro-5-cyano-N-(1,2,4-triazin-3-yl)benzenesulfonamide.
| Compound Name | 2-chloro-5-cyano-N-(1,2,4-triazin-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 114387982 |
| Molecular Formula | C10H6ClN5O2S |
| Molecular Weight | 295.71 g/mol |
| Exact Mass | 294.99 |
| IUPAC Name | 2-chloro-5-cyano-N-(1,2,4-triazin-3-yl)benzenesulfonamide |
| SMILES | N#Cc1ccc(Cl)c(S(=O)(=O)Nc2nccnn2)c1 |
| InChI | InChI=1S/C10H6ClN5O2S/c11-8-2-1-7(6-12)5-9(8)19(17,18)16-10-13-3-4-14-15-10/h1-5H,(H,13,15,16) |
| InChIKey | GGTPGTVIQHGAQX-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.71 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |