C11H7ClN4O2S — CID 80704266
2-chloro-5-cyano-N-pyrazin-2-ylbenzenesulfonamide (PubChem CID 80704266) has the molecular formula C11H7ClN4O2S and a molecular weight of 294.72 g/mol. Its IUPAC name is 2-chloro-5-cyano-N-pyrazin-2-ylbenzenesulfonamide.
| Compound Name | 2-chloro-5-cyano-N-pyrazin-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 80704266 |
| Molecular Formula | C11H7ClN4O2S |
| Molecular Weight | 294.72 g/mol |
| Exact Mass | 294.00 |
| IUPAC Name | 2-chloro-5-cyano-N-pyrazin-2-ylbenzenesulfonamide |
| SMILES | N#Cc1ccc(Cl)c(S(=O)(=O)Nc2cnccn2)c1 |
| InChI | InChI=1S/C11H7ClN4O2S/c12-9-2-1-8(6-13)5-10(9)19(17,18)16-11-7-14-3-4-15-11/h1-5,7H,(H,15,16) |
| InChIKey | OONCDGRYNOCJFX-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.72 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |