C13H10ClN3O2S — CID 80704923
2-chloro-5-cyano-N-(5-methyl-2-pyridinyl)benzenesulfonamide (PubChem CID 80704923) has the molecular formula C13H10ClN3O2S and a molecular weight of 307.76 g/mol. Its IUPAC name is 2-chloro-5-cyano-N-(5-methyl-2-pyridinyl)benzenesulfonamide.
| Compound Name | 2-chloro-5-cyano-N-(5-methyl-2-pyridinyl)benzenesulfonamide |
|---|---|
| PubChem CID | 80704923 |
| Molecular Formula | C13H10ClN3O2S |
| Molecular Weight | 307.76 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | 2-chloro-5-cyano-N-(5-methyl-2-pyridinyl)benzenesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2cc(C#N)ccc2Cl)nc1 |
| InChI | InChI=1S/C13H10ClN3O2S/c1-9-2-5-13(16-8-9)17-20(18,19)12-6-10(7-15)3-4-11(12)14/h2-6,8H,1H3,(H,16,17) |
| InChIKey | WORYBOKIUZHCGW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.76 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |