C10H5Cl2N3O2S2 — CID 62355556
2,5-dichloro-N-(5-cyano-2-pyridinyl)thiophene-3-sulfonamide (PubChem CID 62355556) has the molecular formula C10H5Cl2N3O2S2 and a molecular weight of 334.21 g/mol. Its IUPAC name is 2,5-dichloro-N-(5-cyano-2-pyridinyl)thiophene-3-sulfonamide.
| Compound Name | 2,5-dichloro-N-(5-cyano-2-pyridinyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 62355556 |
| Molecular Formula | C10H5Cl2N3O2S2 |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 332.92 |
| IUPAC Name | 2,5-dichloro-N-(5-cyano-2-pyridinyl)thiophene-3-sulfonamide |
| SMILES | N#Cc1ccc(NS(=O)(=O)c2cc(Cl)sc2Cl)nc1 |
| InChI | InChI=1S/C10H5Cl2N3O2S2/c11-8-3-7(10(12)18-8)19(16,17)15-9-2-1-6(4-13)5-14-9/h1-3,5H,(H,14,15) |
| InChIKey | JYLZXRBUDNGVKR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |