C11H6N4O2S2 — CID 106266766
5-cyano-N-(5-cyano-2-pyridinyl)thiophene-2-sulfonamide (PubChem CID 106266766) has the molecular formula C11H6N4O2S2 and a molecular weight of 290.33 g/mol. Its IUPAC name is 5-cyano-N-(5-cyano-2-pyridinyl)thiophene-2-sulfonamide.
| Compound Name | 5-cyano-N-(5-cyano-2-pyridinyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106266766 |
| Molecular Formula | C11H6N4O2S2 |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 289.99 |
| IUPAC Name | 5-cyano-N-(5-cyano-2-pyridinyl)thiophene-2-sulfonamide |
| SMILES | N#Cc1ccc(NS(=O)(=O)c2ccc(C#N)s2)nc1 |
| InChI | InChI=1S/C11H6N4O2S2/c12-5-8-1-3-10(14-7-8)15-19(16,17)11-4-2-9(6-13)18-11/h1-4,7H,(H,14,15) |
| InChIKey | LSOZFHDZNLPAHR-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 106.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |