C10H8N4O2S2 — CID 106265124
N-(5-amino-2-pyridinyl)-5-cyanothiophene-2-sulfonamide (PubChem CID 106265124) has the molecular formula C10H8N4O2S2 and a molecular weight of 280.33 g/mol. Its IUPAC name is N-(5-amino-2-pyridinyl)-5-cyanothiophene-2-sulfonamide.
| Compound Name | N-(5-amino-2-pyridinyl)-5-cyanothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106265124 |
| Molecular Formula | C10H8N4O2S2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | N-(5-amino-2-pyridinyl)-5-cyanothiophene-2-sulfonamide |
| SMILES | N#Cc1ccc(S(=O)(=O)Nc2ccc(N)cn2)s1 |
| InChI | InChI=1S/C10H8N4O2S2/c11-5-8-2-4-10(17-8)18(15,16)14-9-3-1-7(12)6-13-9/h1-4,6H,12H2,(H,13,14) |
| InChIKey | RWQYXYBDZKIYII-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 108.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |