C11H7F2N3O2S2 — CID 106265286
N-(6-amino-2,3-difluorophenyl)-5-cyanothiophene-2-sulfonamide (PubChem CID 106265286) has the molecular formula C11H7F2N3O2S2 and a molecular weight of 315.33 g/mol. Its IUPAC name is N-(6-amino-2,3-difluorophenyl)-5-cyanothiophene-2-sulfonamide.
| Compound Name | N-(6-amino-2,3-difluorophenyl)-5-cyanothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106265286 |
| Molecular Formula | C11H7F2N3O2S2 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 314.99 |
| IUPAC Name | N-(6-amino-2,3-difluorophenyl)-5-cyanothiophene-2-sulfonamide |
| SMILES | N#Cc1ccc(S(=O)(=O)Nc2c(N)ccc(F)c2F)s1 |
| InChI | InChI=1S/C11H7F2N3O2S2/c12-7-2-3-8(15)11(10(7)13)16-20(17,18)9-4-1-6(5-14)19-9/h1-4,16H,15H2 |
| InChIKey | RPIZXCAETIWZFT-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|