C10H6FN3O2S2 — CID 106268431
5-cyano-N-(5-fluoro-2-pyridinyl)thiophene-2-sulfonamide (PubChem CID 106268431) has the molecular formula C10H6FN3O2S2 and a molecular weight of 283.31 g/mol. Its IUPAC name is 5-cyano-N-(5-fluoro-2-pyridinyl)thiophene-2-sulfonamide.
| Compound Name | 5-cyano-N-(5-fluoro-2-pyridinyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106268431 |
| Molecular Formula | C10H6FN3O2S2 |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 282.99 |
| IUPAC Name | 5-cyano-N-(5-fluoro-2-pyridinyl)thiophene-2-sulfonamide |
| SMILES | N#Cc1ccc(S(=O)(=O)Nc2ccc(F)cn2)s1 |
| InChI | InChI=1S/C10H6FN3O2S2/c11-7-1-3-9(13-6-7)14-18(15,16)10-4-2-8(5-12)17-10/h1-4,6H,(H,13,14) |
| InChIKey | SBYRPPXUVFQPMY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |