C9H8FN3O2S2 — CID 65482445
4-amino-N-(5-fluoro-2-pyridinyl)thiophene-2-sulfonamide (PubChem CID 65482445) has the molecular formula C9H8FN3O2S2 and a molecular weight of 273.31 g/mol. Its IUPAC name is 4-amino-N-(5-fluoro-2-pyridinyl)thiophene-2-sulfonamide.
| Compound Name | 4-amino-N-(5-fluoro-2-pyridinyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 65482445 |
| Molecular Formula | C9H8FN3O2S2 |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | 4-amino-N-(5-fluoro-2-pyridinyl)thiophene-2-sulfonamide |
| SMILES | Nc1csc(S(=O)(=O)Nc2ccc(F)cn2)c1 |
| InChI | InChI=1S/C9H8FN3O2S2/c10-6-1-2-8(12-4-6)13-17(14,15)9-3-7(11)5-16-9/h1-5H,11H2,(H,12,13) |
| InChIKey | OEIGIMWZKOCBMM-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |