C11H7N3O4S2 — CID 106265503
6-[(5-cyanothiophen-2-yl)sulfonylamino]pyridine-3-carboxylic acid (PubChem CID 106265503) has the molecular formula C11H7N3O4S2 and a molecular weight of 309.33 g/mol. Its IUPAC name is 6-[(5-cyanothiophen-2-yl)sulfonylamino]pyridine-3-carboxylic acid.
| Compound Name | 6-[(5-cyanothiophen-2-yl)sulfonylamino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 106265503 |
| Molecular Formula | C11H7N3O4S2 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 308.99 |
| IUPAC Name | 6-[(5-cyanothiophen-2-yl)sulfonylamino]pyridine-3-carboxylic acid |
| SMILES | N#Cc1ccc(S(=O)(=O)Nc2ccc(C(=O)O)cn2)s1 |
| InChI | InChI=1S/C11H7N3O4S2/c12-5-8-2-4-10(19-8)20(17,18)14-9-3-1-7(6-13-9)11(15)16/h1-4,6H,(H,13,14)(H,15,16) |
| InChIKey | ZAUBRPUHGPDJMC-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 120.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |