C13H12N4O2S — CID 106918913
N-(5-amino-2-pyridinyl)-4-cyano-3-methylbenzenesulfonamide (PubChem CID 106918913) has the molecular formula C13H12N4O2S and a molecular weight of 288.33 g/mol. Its IUPAC name is N-(5-amino-2-pyridinyl)-4-cyano-3-methylbenzenesulfonamide.
| Compound Name | N-(5-amino-2-pyridinyl)-4-cyano-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 106918913 |
| Molecular Formula | C13H12N4O2S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | N-(5-amino-2-pyridinyl)-4-cyano-3-methylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)Nc2ccc(N)cn2)ccc1C#N |
| InChI | InChI=1S/C13H12N4O2S/c1-9-6-12(4-2-10(9)7-14)20(18,19)17-13-5-3-11(15)8-16-13/h2-6,8H,15H2,1H3,(H,16,17) |
| InChIKey | DTDSEZHYIVSKSO-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 108.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |