C12H9N5O2S — CID 106919695
4-cyano-N-(4-cyano-1H-pyrazol-5-yl)-3-methylbenzenesulfonamide (PubChem CID 106919695) has the molecular formula C12H9N5O2S and a molecular weight of 287.30 g/mol. Its IUPAC name is 4-cyano-N-(4-cyano-1H-pyrazol-5-yl)-3-methylbenzenesulfonamide.
| Compound Name | 4-cyano-N-(4-cyano-1H-pyrazol-5-yl)-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 106919695 |
| Molecular Formula | C12H9N5O2S |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 4-cyano-N-(4-cyano-1H-pyrazol-5-yl)-3-methylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)Nc2[nH]ncc2C#N)ccc1C#N |
| InChI | InChI=1S/C12H9N5O2S/c1-8-4-11(3-2-9(8)5-13)20(18,19)17-12-10(6-14)7-15-16-12/h2-4,7H,1H3,(H2,15,16,17) |
| InChIKey | FBYOZHPPQLINBS-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 122.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |