C10H6N6O2S — CID 115897741
6-cyano-N-(4-cyano-1H-pyrazol-5-yl)pyridine-3-sulfonamide (PubChem CID 115897741) has the molecular formula C10H6N6O2S and a molecular weight of 274.27 g/mol. Its IUPAC name is 6-cyano-N-(4-cyano-1H-pyrazol-5-yl)pyridine-3-sulfonamide.
| Compound Name | 6-cyano-N-(4-cyano-1H-pyrazol-5-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 115897741 |
| Molecular Formula | C10H6N6O2S |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | 6-cyano-N-(4-cyano-1H-pyrazol-5-yl)pyridine-3-sulfonamide |
| SMILES | N#Cc1ccc(S(=O)(=O)Nc2[nH]ncc2C#N)cn1 |
| InChI | InChI=1S/C10H6N6O2S/c11-3-7-5-14-15-10(7)16-19(17,18)9-2-1-8(4-12)13-6-9/h1-2,5-6H,(H2,14,15,16) |
| InChIKey | SMJXRLVFBNBIIG-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 135.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |