C8H7N7O2S — CID 114613899
6-cyano-N-(2-methyltetrazol-5-yl)pyridine-3-sulfonamide (PubChem CID 114613899) has the molecular formula C8H7N7O2S and a molecular weight of 265.26 g/mol. Its IUPAC name is 6-cyano-N-(2-methyltetrazol-5-yl)pyridine-3-sulfonamide.
| Compound Name | 6-cyano-N-(2-methyltetrazol-5-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 114613899 |
| Molecular Formula | C8H7N7O2S |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | 6-cyano-N-(2-methyltetrazol-5-yl)pyridine-3-sulfonamide |
| SMILES | Cn1nnc(NS(=O)(=O)c2ccc(C#N)nc2)n1 |
| InChI | InChI=1S/C8H7N7O2S/c1-15-12-8(11-14-15)13-18(16,17)7-3-2-6(4-9)10-5-7/h2-3,5H,1H3,(H,12,13) |
| InChIKey | ZMVGSGIFIXYKDM-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 126.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |