C8H10N8O4S — CID 82847860
3-hydrazinyl-N-(2-methyltetrazol-5-yl)-4-nitrobenzenesulfonamide (PubChem CID 82847860) has the molecular formula C8H10N8O4S and a molecular weight of 314.29 g/mol. Its IUPAC name is 3-hydrazinyl-N-(2-methyltetrazol-5-yl)-4-nitrobenzenesulfonamide.
| Compound Name | 3-hydrazinyl-N-(2-methyltetrazol-5-yl)-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 82847860 |
| Molecular Formula | C8H10N8O4S |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 3-hydrazinyl-N-(2-methyltetrazol-5-yl)-4-nitrobenzenesulfonamide |
| SMILES | Cn1nnc(NS(=O)(=O)c2ccc([N+](=O)[O-])c(NN)c2)n1 |
| InChI | InChI=1S/C8H10N8O4S/c1-15-12-8(11-14-15)13-21(19,20)5-2-3-7(16(17)18)6(4-5)10-9/h2-4,10H,9H2,1H3,(H,12,13) |
| InChIKey | SZVTZDLSQZTOFM-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 170.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|