C10H14N4O6S — CID 106670078
1-(3-hydrazinyl-4-nitrophenyl)sulfonylpyrrolidine-3,4-diol (PubChem CID 106670078) has the molecular formula C10H14N4O6S and a molecular weight of 318.31 g/mol. Its IUPAC name is 1-(3-hydrazinyl-4-nitrophenyl)sulfonylpyrrolidine-3,4-diol.
| Compound Name | 1-(3-hydrazinyl-4-nitrophenyl)sulfonylpyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106670078 |
| Molecular Formula | C10H14N4O6S |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 1-(3-hydrazinyl-4-nitrophenyl)sulfonylpyrrolidine-3,4-diol |
| SMILES | NNc1cc(S(=O)(=O)N2CC(O)C(O)C2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H14N4O6S/c11-12-7-3-6(1-2-8(7)14(17)18)21(19,20)13-4-9(15)10(16)5-13/h1-3,9-10,12,15-16H,4-5,11H2 |
| InChIKey | DKIRDJOFLLYPBY-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 159.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|