C11H8Br2N4O2S — CID 81327392
2,5-dibromo-N-(4-cyano-1H-pyrazol-5-yl)-4-methylbenzenesulfonamide (PubChem CID 81327392) has the molecular formula C11H8Br2N4O2S and a molecular weight of 420.09 g/mol. Its IUPAC name is 2,5-dibromo-N-(4-cyano-1H-pyrazol-5-yl)-4-methylbenzenesulfonamide.
| Compound Name | 2,5-dibromo-N-(4-cyano-1H-pyrazol-5-yl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 81327392 |
| Molecular Formula | C11H8Br2N4O2S |
| Molecular Weight | 420.09 g/mol |
| Exact Mass | 417.87 |
| IUPAC Name | 2,5-dibromo-N-(4-cyano-1H-pyrazol-5-yl)-4-methylbenzenesulfonamide |
| SMILES | Cc1cc(Br)c(S(=O)(=O)Nc2[nH]ncc2C#N)cc1Br |
| InChI | InChI=1S/C11H8Br2N4O2S/c1-6-2-9(13)10(3-8(6)12)20(18,19)17-11-7(4-14)5-15-16-11/h2-3,5H,1H3,(H2,15,16,17) |
| InChIKey | LDFSGBQNLOOELQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.09 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |