C10H6Cl2N4O2S — CID 79503678
2,5-dichloro-N-(4-cyano-1H-pyrazol-5-yl)benzenesulfonamide (PubChem CID 79503678) has the molecular formula C10H6Cl2N4O2S and a molecular weight of 317.16 g/mol. Its IUPAC name is 2,5-dichloro-N-(4-cyano-1H-pyrazol-5-yl)benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-(4-cyano-1H-pyrazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 79503678 |
| Molecular Formula | C10H6Cl2N4O2S |
| Molecular Weight | 317.16 g/mol |
| Exact Mass | 315.96 |
| IUPAC Name | 2,5-dichloro-N-(4-cyano-1H-pyrazol-5-yl)benzenesulfonamide |
| SMILES | N#Cc1cn[nH]c1NS(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C10H6Cl2N4O2S/c11-7-1-2-8(12)9(3-7)19(17,18)16-10-6(4-13)5-14-15-10/h1-3,5H,(H2,14,15,16) |
| InChIKey | OYVDABSOCBZPJU-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.16 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |