C11H6Cl2N4O — CID 79503936
2,4-dichloro-N-(4-cyano-1H-pyrazol-5-yl)benzamide (PubChem CID 79503936) has the molecular formula C11H6Cl2N4O and a molecular weight of 281.10 g/mol. Its IUPAC name is 2,4-dichloro-N-(4-cyano-1H-pyrazol-5-yl)benzamide.
| Compound Name | 2,4-dichloro-N-(4-cyano-1H-pyrazol-5-yl)benzamide |
|---|---|
| PubChem CID | 79503936 |
| Molecular Formula | C11H6Cl2N4O |
| Molecular Weight | 281.10 g/mol |
| Exact Mass | 279.99 |
| IUPAC Name | 2,4-dichloro-N-(4-cyano-1H-pyrazol-5-yl)benzamide |
| SMILES | N#Cc1cn[nH]c1NC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H6Cl2N4O/c12-7-1-2-8(9(13)3-7)11(18)16-10-6(4-14)5-15-17-10/h1-3,5H,(H2,15,16,17,18) |
| InChIKey | IDANBBLVUBHDQS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.10 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |