C11H6ClFN4O — CID 107987719
4-chloro-N-(4-cyano-1H-pyrazol-5-yl)-3-fluorobenzamide (PubChem CID 107987719) has the molecular formula C11H6ClFN4O and a molecular weight of 264.65 g/mol. Its IUPAC name is 4-chloro-N-(4-cyano-1H-pyrazol-5-yl)-3-fluorobenzamide.
| Compound Name | 4-chloro-N-(4-cyano-1H-pyrazol-5-yl)-3-fluorobenzamide |
|---|---|
| PubChem CID | 107987719 |
| Molecular Formula | C11H6ClFN4O |
| Molecular Weight | 264.65 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | 4-chloro-N-(4-cyano-1H-pyrazol-5-yl)-3-fluorobenzamide |
| SMILES | N#Cc1cn[nH]c1NC(=O)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C11H6ClFN4O/c12-8-2-1-6(3-9(8)13)11(18)16-10-7(4-14)5-15-17-10/h1-3,5H,(H2,15,16,17,18) |
| InChIKey | WSDNOIJSSDXPSY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.65 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |