C12H9ClN4O — CID 110473457
3-chloro-N-(4-cyano-1H-pyrazol-5-yl)-2-methylbenzamide (PubChem CID 110473457) has the molecular formula C12H9ClN4O and a molecular weight of 260.68 g/mol. Its IUPAC name is 3-chloro-N-(4-cyano-1H-pyrazol-5-yl)-2-methylbenzamide.
| Compound Name | 3-chloro-N-(4-cyano-1H-pyrazol-5-yl)-2-methylbenzamide |
|---|---|
| PubChem CID | 110473457 |
| Molecular Formula | C12H9ClN4O |
| Molecular Weight | 260.68 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 3-chloro-N-(4-cyano-1H-pyrazol-5-yl)-2-methylbenzamide |
| SMILES | Cc1c(Cl)cccc1C(=O)Nc1[nH]ncc1C#N |
| InChI | InChI=1S/C12H9ClN4O/c1-7-9(3-2-4-10(7)13)12(18)16-11-8(5-14)6-15-17-11/h2-4,6H,1H3,(H2,15,16,17,18) |
| InChIKey | VUOGWWLDFQFWKJ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.68 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |