C12H9N5O3 — CID 78913751
N-(4-cyano-1H-pyrazol-5-yl)-3-methyl-4-nitrobenzamide (PubChem CID 78913751) has the molecular formula C12H9N5O3 and a molecular weight of 271.24 g/mol. Its IUPAC name is N-(4-cyano-1H-pyrazol-5-yl)-3-methyl-4-nitrobenzamide.
| Compound Name | N-(4-cyano-1H-pyrazol-5-yl)-3-methyl-4-nitrobenzamide |
|---|---|
| PubChem CID | 78913751 |
| Molecular Formula | C12H9N5O3 |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | N-(4-cyano-1H-pyrazol-5-yl)-3-methyl-4-nitrobenzamide |
| SMILES | Cc1cc(C(=O)Nc2[nH]ncc2C#N)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H9N5O3/c1-7-4-8(2-3-10(7)17(19)20)12(18)15-11-9(5-13)6-14-16-11/h2-4,6H,1H3,(H2,14,15,16,18) |
| InChIKey | MRRMIIVLIZTPEB-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 124.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|