C12H10N4O5 — CID 64528441
3-[(3-methyl-4-nitrobenzoyl)amino]-1H-pyrazole-5-carboxylic acid (PubChem CID 64528441) has the molecular formula C12H10N4O5 and a molecular weight of 290.24 g/mol. Its IUPAC name is 3-[(3-methyl-4-nitrobenzoyl)amino]-1H-pyrazole-5-carboxylic acid.
| Compound Name | 3-[(3-methyl-4-nitrobenzoyl)amino]-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 64528441 |
| Molecular Formula | C12H10N4O5 |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 3-[(3-methyl-4-nitrobenzoyl)amino]-1H-pyrazole-5-carboxylic acid |
| SMILES | Cc1cc(C(=O)Nc2cc(C(=O)O)[nH]n2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H10N4O5/c1-6-4-7(2-3-9(6)16(20)21)11(17)13-10-5-8(12(18)19)14-15-10/h2-5H,1H3,(H,18,19)(H2,13,14,15,17) |
| InChIKey | GYWRTJZOLZRXFL-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 138.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|