C13H13N3O5 — CID 64528227
3-[(3,4-dimethoxybenzoyl)amino]-1H-pyrazole-5-carboxylic acid (PubChem CID 64528227) has the molecular formula C13H13N3O5 and a molecular weight of 291.26 g/mol. Its IUPAC name is 3-[(3,4-dimethoxybenzoyl)amino]-1H-pyrazole-5-carboxylic acid.
| Compound Name | 3-[(3,4-dimethoxybenzoyl)amino]-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 64528227 |
| Molecular Formula | C13H13N3O5 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 3-[(3,4-dimethoxybenzoyl)amino]-1H-pyrazole-5-carboxylic acid |
| SMILES | COc1ccc(C(=O)Nc2cc(C(=O)O)[nH]n2)cc1OC |
| InChI | InChI=1S/C13H13N3O5/c1-20-9-4-3-7(5-10(9)21-2)12(17)14-11-6-8(13(18)19)15-16-11/h3-6H,1-2H3,(H,18,19)(H2,14,15,16,17) |
| InChIKey | SLNSJXIQLKXAFB-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 113.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |