C11H8ClN3O4 — CID 64528240
3-[(3-chloro-4-hydroxybenzoyl)amino]-1H-pyrazole-5-carboxylic acid (PubChem CID 64528240) has the molecular formula C11H8ClN3O4 and a molecular weight of 281.66 g/mol. Its IUPAC name is 3-[(3-chloro-4-hydroxybenzoyl)amino]-1H-pyrazole-5-carboxylic acid.
| Compound Name | 3-[(3-chloro-4-hydroxybenzoyl)amino]-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 64528240 |
| Molecular Formula | C11H8ClN3O4 |
| Molecular Weight | 281.66 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | 3-[(3-chloro-4-hydroxybenzoyl)amino]-1H-pyrazole-5-carboxylic acid |
| SMILES | O=C(Nc1cc(C(=O)O)[nH]n1)c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C11H8ClN3O4/c12-6-3-5(1-2-8(6)16)10(17)13-9-4-7(11(18)19)14-15-9/h1-4,16H,(H,18,19)(H2,13,14,15,17) |
| InChIKey | PJGCZZUUEJFWIY-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 115.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.66 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |